> For the complete documentation index, see [llms.txt](https://globalchem.gitbook.io/globalchem-your-chemical-graph-network/llms.txt). Markdown versions of documentation pages are available by appending `.md` to page URLs; this page is available as [Markdown](https://globalchem.gitbook.io/globalchem-your-chemical-graph-network/cheminformatics/amino-acid-sequence-to-smiles.md).

# Amino Acid Sequence to SMILES

{% tabs %}
{% tab title="Code" %}

```
cheminformatics.smiles_to_amino_acids(smiles)
```

{% endtab %}

{% tab title="Output" %}

{% endtab %}
{% endtabs %}

**Algorithm** 

{% tabs %}
{% tab title="Amino Acids to SMILES" %}

```
amino_acids_sequence = {
    "A": "C",
    "R": "CCCCNC(N)=N",
    "N": "CC(N)=O",
    "D": "CC(O)=O",
    "B": "CC(O)=O",
    "C": "CS",
    "E": "CCC(O)=O",
    "Q": "CCC(N)=O",
    "Z": "CCC(N)=O",
    "G": "[H]",
    "H": "CC1=CNC=N1",
    "I": "C(CC)([H])C",
    "L": "CC(C)C",
    "K": "CCCCN",
    "M": "CCSC",
    "F": "CC1=CC=CC=C1",
    "P": "C2CCCN2",
    "S": "CO",
    "T": "C(C)([H])O",
    "W": "CCC1=CNC2=C1C=CC=C2",
    "Y": "CC1=CC=C(O)C=C1",
    "V": "C(C)C"
}
```

{% endtab %}

{% tab title="SMILES to Amino Acids" %}

```
amino_acids_sequence = {
            "C" :"A",
            "CCCCNC(N)=N":"R",
            "CC(N)=O":"N",
            "CC(O)=O":"D",
            "CS": "C",
            "CCC(O)=O":"E",
            "CCC(N)=O":"Q",
            "[H]":"G",
            "CC1=CNC=N1" :"H",
            "C(CC)([H])C" :"I",
            "CC(C)C" :"L",
            "CCCCN" :"K",
            "CCSC" :"M",
            "CC1=CC=CC=C1" :"F",
            "C2CCCN2" :"P",
            "CO" :"S",
            "C(C)([H])O" :"T",
            "CCC1=CNC2=C1C=CC=C2" :"W",
            "CC1=CC=C(O)C=C1":"Y",
            "C(C)C" :"V",
}
```

{% endtab %}
{% endtabs %}

So when the user passes in a string of Amino Acids, we build the peptide string in accordance to the length of the string and fill the slots appropriately with amino acid fragments. 

```
RSTEFGHIKLADPQ
NC(CCCCNC(N)=N)C(NC(CO)C(NC(C(C)([H])O)C(NC(CCC(O)=O)C(NC(CC1=CC=CC=C1)C(NC([H])C(NC(CC1=CNC=N1)C(NC(C(CC)([H])C)C(NC(CCCCN)C(NC(CC(C)C)C(NC(C)C(NC(CC(O)=O)C(NC(C2CCCN2)C(NC(CCC(N)=O)C(NCC(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O
```

To convert the SMILES string back into an amino acid sequence a reverse list is created and a regex pattern is used to search for the slots within a SMILES string. 

```
pattern = re.compile('NC\(.*?\)C\(', flags=re.MULTILINE)
```

Then replaces the fragment with the amino acid. 

```
NC(CCCCNC(N)=N)C(NC(CO)C(NC(C(C)([H])O)C(NC(CCC(O)=O)C(NC(CC1=CC=CC=C1)C(NC([H])C(NC(CC1=CNC=N1)C(NC(C(CC)([H])C)C(NC(CCCCN)C(NC(CC(C)C)C(NC(C)C(NC(CC(O)=O)C(NC(C2CCCN2)C(NC(CCC(N)=O)C(NCC(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O
RSTEFGHIKLADPQ
```

**References**

1. Sharif, Suliman. “Cocktail Shaker: An Open Source Drug Expansion and Enumeration Library for Peptides.” *Journal of Open Source Software*, vol. 5, no. 52, Aug. 2020, p. 1992. *joss.theoj.org*, <https://doi.org/10.21105/joss.01992>.